C32H44N6O2 — CID 143188932
methane;N-[[2-methyl-4-(4-methyl-2,4,5,9-tetrazatricyclo[8.5.0.03,7]pentadeca-1(15),3(7),5,11,13-pentaene-9-carbonyl)phenyl]methyl]-2-piperidin-4-ylacetamide;prop-1-ene (PubChem CID 143188932) has the molecular formula C32H44N6O2 and a molecular weight of 544.74 g/mol. Its IUPAC name is methane;N-[[2-methyl-4-(4-methyl-2,4,5,9-tetrazatricyclo[8.5.0.03,7]pentadeca-1(15),3(7),5,11,13-pentaene-9-carbonyl)phenyl]methyl]-2-piperidin-4-ylacetamide;prop-1-ene.
| Compound Name | methane;N-[[2-methyl-4-(4-methyl-2,4,5,9-tetrazatricyclo[8.5.0.03,7]pentadeca-1(15),3(7),5,11,13-pentaene-9-carbonyl)phenyl]methyl]-2-piperidin-4-ylacetamide;prop-1-ene |
|---|---|
| PubChem CID | 143188932 |
| Molecular Formula | C32H44N6O2 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.35 |
| IUPAC Name | methane;N-[[2-methyl-4-(4-methyl-2,4,5,9-tetrazatricyclo[8.5.0.03,7]pentadeca-1(15),3(7),5,11,13-pentaene-9-carbonyl)phenyl]methyl]-2-piperidin-4-ylacetamide;prop-1-ene |
| SMILES | C.C=CC.Cc1cc(C(=O)N2Cc3cnn(C)c3NC3=CC=CC=CC32)ccc1CNC(=O)CC1CCNCC1 |
| InChI | InChI=1S/C28H34N6O2.C3H6.CH4/c1-19-14-21(8-9-22(19)16-30-26(35)15-20-10-12-29-13-11-20)28(36)34-18-23-17-31-33(2)27(23)32-24-6-4-3-5-7-25(24)34;1-3-2;/h3-9,14,17,20,25,29,32H,10-13,15-16,18H2,1-2H3,(H,30,35);3H,1H2,2H3;1H4 |
| InChIKey | DBAUSXIVHYDOAB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|