C33H43IN8O2S — CID 135546556
2-(4,4-dimethyl-1,4-diazepan-4-ium-1-carbothioyl)-N-[[2-methyl-4-(1-methyl-4,10-dihydropyrazolo[4,5-c][1,5]benzodiazepine-5-carbonyl)phenyl]methyl]pyrrolidine-1-carboxamide iodide (PubChem CID 135546556) has the molecular formula C33H43IN8O2S and a molecular weight of 742.73 g/mol. Its IUPAC name is 2-(4,4-dimethyl-1,4-diazepan-4-ium-1-carbothioyl)-N-[[2-methyl-4-(1-methyl-4,10-dihydropyrazolo[4,5-c][1,5]benzodiazepine-5-carbonyl)phenyl]methyl]pyrrolidine-1-carboxamide iodide.
| Compound Name | 2-(4,4-dimethyl-1,4-diazepan-4-ium-1-carbothioyl)-N-[[2-methyl-4-(1-methyl-4,10-dihydropyrazolo[4,5-c][1,5]benzodiazepine-5-carbonyl)phenyl]methyl]pyrrolidine-1-carboxamide iodide |
|---|---|
| PubChem CID | 135546556 |
| Molecular Formula | C33H43IN8O2S |
| Molecular Weight | 742.73 g/mol |
| Exact Mass | 742.23 |
| IUPAC Name | 2-(4,4-dimethyl-1,4-diazepan-4-ium-1-carbothioyl)-N-[[2-methyl-4-(1-methyl-4,10-dihydropyrazolo[4,5-c][1,5]benzodiazepine-5-carbonyl)phenyl]methyl]pyrrolidine-1-carboxamide iodide |
| SMILES | Cc1cc(C(=O)N2Cc3cnn(C)c3Nc3ccccc32)ccc1CNC(=O)N1CCCC1C(=S)N1CCC[N+](C)(C)CC1.[I-] |
| InChI | InChI=1S/C33H42N8O2S.HI/c1-23-19-24(31(42)40-22-26-21-35-37(2)30(26)36-27-9-5-6-10-28(27)40)12-13-25(23)20-34-33(43)39-15-7-11-29(39)32(44)38-14-8-17-41(3,4)18-16-38;/h5-6,9-10,12-13,19,21,29H,7-8,11,14-18,20,22H2,1-4H3,(H-,34,35,36,43);1H |
| InChIKey | TYUUSEGWQUSBKK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 85.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.73 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|