C28H32N7O2S — CID 156588583
CID 156588583 (PubChem CID 156588583) has the molecular formula C28H32N7O2S and a molecular weight of 530.68 g/mol.
| Compound Name | CID 156588583 |
|---|---|
| PubChem CID | 156588583 |
| Molecular Formula | C28H32N7O2S |
| Molecular Weight | 530.68 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | — |
| SMILES | Cc1cc(C(=O)N2Cc3cnn(C)c3Nc3ccccc32)ccc1CNC(=O)N1CCCC1=C([S])N(C)C |
| InChI | InChI=1S/C28H32N7O2S/c1-18-14-19(11-12-20(18)15-29-28(37)34-13-7-10-24(34)27(38)32(2)3)26(36)35-17-21-16-30-33(4)25(21)31-22-8-5-6-9-23(22)35/h5-6,8-9,11-12,14,16,31H,7,10,13,15,17H2,1-4H3,(H,29,37) |
| InChIKey | ULADXMMHGDXJTH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 85.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.68 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |