C27H31N5NaO3 — CID 172735905
CID 172735905 (PubChem CID 172735905) has the molecular formula C27H31N5NaO3 and a molecular weight of 496.57 g/mol.
| Compound Name | CID 172735905 |
|---|---|
| PubChem CID | 172735905 |
| Molecular Formula | C27H31N5NaO3 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | — |
| SMILES | Cc1cc(C(=O)N2Cc3cnn(C)c3Nc3ccccc32)ccc1CCC(=O)N1CCC(O)CC1.[Na] |
| InChI | InChI=1S/C27H31N5O3.Na/c1-18-15-20(8-7-19(18)9-10-25(34)31-13-11-22(33)12-14-31)27(35)32-17-21-16-28-30(2)26(21)29-23-5-3-4-6-24(23)32;/h3-8,15-16,22,29,33H,9-14,17H2,1-2H3; |
| InChIKey | IKWCSYHUGCUQTI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |