C15H23Br2N — CID 143189094
4-[4-(1,2-dibromoethyl)cyclohexyl]cyclohexane-1-carbonitrile (PubChem CID 143189094) has the molecular formula C15H23Br2N and a molecular weight of 377.16 g/mol. Its IUPAC name is 4-[4-(1,2-dibromoethyl)cyclohexyl]cyclohexane-1-carbonitrile.
| Compound Name | 4-[4-(1,2-dibromoethyl)cyclohexyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 143189094 |
| Molecular Formula | C15H23Br2N |
| Molecular Weight | 377.16 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 4-[4-(1,2-dibromoethyl)cyclohexyl]cyclohexane-1-carbonitrile |
| SMILES | N#CC1CCC(C2CCC(C(Br)CBr)CC2)CC1 |
| InChI | InChI=1S/C15H23Br2N/c16-9-15(17)14-7-5-13(6-8-14)12-3-1-11(10-18)2-4-12/h11-15H,1-9H2 |
| InChIKey | QDLFRLDOVMCMIT-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.16 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|