C19H36Br2 — CID 143189115
1-(1,3-dibromopropyl)-4-(4-ethylcyclohexyl)cyclohexane;ethane (PubChem CID 143189115) has the molecular formula C19H36Br2 and a molecular weight of 424.31 g/mol. Its IUPAC name is 1-(1,3-dibromopropyl)-4-(4-ethylcyclohexyl)cyclohexane;ethane.
| Compound Name | 1-(1,3-dibromopropyl)-4-(4-ethylcyclohexyl)cyclohexane;ethane |
|---|---|
| PubChem CID | 143189115 |
| Molecular Formula | C19H36Br2 |
| Molecular Weight | 424.31 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 1-(1,3-dibromopropyl)-4-(4-ethylcyclohexyl)cyclohexane;ethane |
| SMILES | CC.CCC1CCC(C2CCC(C(Br)CCBr)CC2)CC1 |
| InChI | InChI=1S/C17H30Br2.C2H6/c1-2-13-3-5-14(6-4-13)15-7-9-16(10-8-15)17(19)11-12-18;1-2/h13-17H,2-12H2,1H3;1-2H3 |
| InChIKey | XNMOFUXRQKAMQM-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.31 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|