C11H20Br2 — CID 143189169
1-(1,3-dibromopropyl)-4-ethylcyclohexane (PubChem CID 143189169) has the molecular formula C11H20Br2 and a molecular weight of 312.09 g/mol. Its IUPAC name is 1-(1,3-dibromopropyl)-4-ethylcyclohexane.
| Compound Name | 1-(1,3-dibromopropyl)-4-ethylcyclohexane |
|---|---|
| PubChem CID | 143189169 |
| Molecular Formula | C11H20Br2 |
| Molecular Weight | 312.09 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | 1-(1,3-dibromopropyl)-4-ethylcyclohexane |
| SMILES | CCC1CCC(C(Br)CCBr)CC1 |
| InChI | InChI=1S/C11H20Br2/c1-2-9-3-5-10(6-4-9)11(13)7-8-12/h9-11H,2-8H2,1H3 |
| InChIKey | JNTNTVSDWGRGFQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.09 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|