C34H45FN2O5 — CID 143190374
but-1-ene;7-[5-(4-fluorophenyl)-3-(phenylcarbamoyl)-2-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid;prop-1-ene (PubChem CID 143190374) has the molecular formula C34H45FN2O5 and a molecular weight of 580.74 g/mol. Its IUPAC name is but-1-ene;7-[5-(4-fluorophenyl)-3-(phenylcarbamoyl)-2-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid;prop-1-ene.
| Compound Name | but-1-ene;7-[5-(4-fluorophenyl)-3-(phenylcarbamoyl)-2-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid;prop-1-ene |
|---|---|
| PubChem CID | 143190374 |
| Molecular Formula | C34H45FN2O5 |
| Molecular Weight | 580.74 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | but-1-ene;7-[5-(4-fluorophenyl)-3-(phenylcarbamoyl)-2-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid;prop-1-ene |
| SMILES | C=CC.C=CCC.CC(C)c1c(C(=O)Nc2ccccc2)cc(-c2ccc(F)cc2)n1CCC(O)CC(O)CC(=O)O |
| InChI | InChI=1S/C27H31FN2O5.C4H8.C3H6/c1-17(2)26-23(27(35)29-20-6-4-3-5-7-20)16-24(18-8-10-19(28)11-9-18)30(26)13-12-21(31)14-22(32)15-25(33)34;1-3-4-2;1-3-2/h3-11,16-17,21-22,31-32H,12-15H2,1-2H3,(H,29,35)(H,33,34);3H,1,4H2,2H3;3H,1H2,2H3 |
| InChIKey | KFSKHXXWAVHHDM-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.74 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|