C13H24N2 — CID 143191004
3,4-dimethyl-2,8-diazaspiro[4.5]dec-3-ene;prop-1-ene (PubChem CID 143191004) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 3,4-dimethyl-2,8-diazaspiro[4.5]dec-3-ene;prop-1-ene.
| Compound Name | 3,4-dimethyl-2,8-diazaspiro[4.5]dec-3-ene;prop-1-ene |
|---|---|
| PubChem CID | 143191004 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 3,4-dimethyl-2,8-diazaspiro[4.5]dec-3-ene;prop-1-ene |
| SMILES | C=CC.CC1=C(C)C2(CCNCC2)CN1 |
| InChI | InChI=1S/C10H18N2.C3H6/c1-8-9(2)12-7-10(8)3-5-11-6-4-10;1-3-2/h11-12H,3-7H2,1-2H3;3H,1H2,2H3 |
| InChIKey | GHJASJMHONSDTB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|