C13H22FN — CID 164862654
4-[(2Z,5E)-5-fluorohepta-2,5-dienyl]-4-methylpiperidine (PubChem CID 164862654) has the molecular formula C13H22FN and a molecular weight of 211.32 g/mol. Its IUPAC name is 4-[(2Z,5E)-5-fluorohepta-2,5-dienyl]-4-methylpiperidine.
| Compound Name | 4-[(2Z,5E)-5-fluorohepta-2,5-dienyl]-4-methylpiperidine |
|---|---|
| PubChem CID | 164862654 |
| Molecular Formula | C13H22FN |
| Molecular Weight | 211.32 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 4-[(2Z,5E)-5-fluorohepta-2,5-dienyl]-4-methylpiperidine |
| SMILES | C/C=C(/F)C/C=C\CC1(C)CCNCC1 |
| InChI | InChI=1S/C13H22FN/c1-3-12(14)6-4-5-7-13(2)8-10-15-11-9-13/h3-5,15H,6-11H2,1-2H3/b5-4-,12-3+ |
| InChIKey | XVCIAYXOQFADHK-YPBGMLOESA-N |
| XLogP | 3.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|