C41H51N3O2 — CID 143193042
benzene;3-benzhydryl-1-[2-[[(4Z,7Z)-deca-4,7,9-trien-2-yl]amino]ethyl]-1-ethylurea;phenylmethanol (PubChem CID 143193042) has the molecular formula C41H51N3O2 and a molecular weight of 617.88 g/mol. Its IUPAC name is benzene;3-benzhydryl-1-[2-[[(4Z,7Z)-deca-4,7,9-trien-2-yl]amino]ethyl]-1-ethylurea;phenylmethanol.
| Compound Name | benzene;3-benzhydryl-1-[2-[[(4Z,7Z)-deca-4,7,9-trien-2-yl]amino]ethyl]-1-ethylurea;phenylmethanol |
|---|---|
| PubChem CID | 143193042 |
| Molecular Formula | C41H51N3O2 |
| Molecular Weight | 617.88 g/mol |
| Exact Mass | 617.40 |
| IUPAC Name | benzene;3-benzhydryl-1-[2-[[(4Z,7Z)-deca-4,7,9-trien-2-yl]amino]ethyl]-1-ethylurea;phenylmethanol |
| SMILES | C=C/C=C\C/C=C\CC(C)NCCN(CC)C(=O)NC(c1ccccc1)c1ccccc1.OCc1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C28H37N3O.C7H8O.C6H6/c1-4-6-7-8-9-12-17-24(3)29-22-23-31(5-2)28(32)30-27(25-18-13-10-14-19-25)26-20-15-11-16-21-26;8-6-7-4-2-1-3-5-7;1-2-4-6-5-3-1/h4,6-7,9-16,18-21,24,27,29H,1,5,8,17,22-23H2,2-3H3,(H,30,32);1-5,8H,6H2;1-6H/b7-6-,12-9-;; |
| InChIKey | HUYKMVKYCFDGOE-OMRAVXHGSA-N |
| XLogP | 8.73 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.88 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|