C24H22ClNO4S — CID 143193900
ethyl 2-[N-(1,3-benzodioxol-5-ylsulfanyl)-2-benzyl-4-chloroanilino]acetate (PubChem CID 143193900) has the molecular formula C24H22ClNO4S and a molecular weight of 455.96 g/mol. Its IUPAC name is ethyl 2-[N-(1,3-benzodioxol-5-ylsulfanyl)-2-benzyl-4-chloroanilino]acetate.
| Compound Name | ethyl 2-[N-(1,3-benzodioxol-5-ylsulfanyl)-2-benzyl-4-chloroanilino]acetate |
|---|---|
| PubChem CID | 143193900 |
| Molecular Formula | C24H22ClNO4S |
| Molecular Weight | 455.96 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | ethyl 2-[N-(1,3-benzodioxol-5-ylsulfanyl)-2-benzyl-4-chloroanilino]acetate |
| SMILES | CCOC(=O)CN(Sc1ccc2c(c1)OCO2)c1ccc(Cl)cc1Cc1ccccc1 |
| InChI | InChI=1S/C24H22ClNO4S/c1-2-28-24(27)15-26(31-20-9-11-22-23(14-20)30-16-29-22)21-10-8-19(25)13-18(21)12-17-6-4-3-5-7-17/h3-11,13-14H,2,12,15-16H2,1H3 |
| InChIKey | POXZDIALYRAVPY-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.96 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|