C33H28F3N3O4 — CID 143195239
ethyl (E)-3-[2-amino-4-[4-[5-cyano-1-[(2,4-dimethylphenyl)methyl]-6-oxo-4-(trifluoromethyl)-2-pyridinyl]phenoxy]phenyl]prop-2-enoate (PubChem CID 143195239) has the molecular formula C33H28F3N3O4 and a molecular weight of 587.60 g/mol. Its IUPAC name is ethyl (E)-3-[2-amino-4-[4-[5-cyano-1-[(2,4-dimethylphenyl)methyl]-6-oxo-4-(trifluoromethyl)-2-pyridinyl]phenoxy]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-amino-4-[4-[5-cyano-1-[(2,4-dimethylphenyl)methyl]-6-oxo-4-(trifluoromethyl)-2-pyridinyl]phenoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 143195239 |
| Molecular Formula | C33H28F3N3O4 |
| Molecular Weight | 587.60 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | ethyl (E)-3-[2-amino-4-[4-[5-cyano-1-[(2,4-dimethylphenyl)methyl]-6-oxo-4-(trifluoromethyl)-2-pyridinyl]phenoxy]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(Oc2ccc(-c3cc(C(F)(F)F)c(C#N)c(=O)n3Cc3ccc(C)cc3C)cc2)cc1N |
| InChI | InChI=1S/C33H28F3N3O4/c1-4-42-31(40)14-10-22-7-13-26(16-29(22)38)43-25-11-8-23(9-12-25)30-17-28(33(34,35)36)27(18-37)32(41)39(30)19-24-6-5-20(2)15-21(24)3/h5-17H,4,19,38H2,1-3H3/b14-10+ |
| InChIKey | TTYXAVZFAJBNHR-GXDHUFHOSA-N |
| XLogP | 7.02 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.60 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|