C20H35N — CID 143195376
N,N-dimethyl-1-[4-(2,2,5,5-tetramethylhexan-3-yl)cyclohepta-1,3,5-trien-1-yl]methanamine (PubChem CID 143195376) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is N,N-dimethyl-1-[4-(2,2,5,5-tetramethylhexan-3-yl)cyclohepta-1,3,5-trien-1-yl]methanamine.
| Compound Name | N,N-dimethyl-1-[4-(2,2,5,5-tetramethylhexan-3-yl)cyclohepta-1,3,5-trien-1-yl]methanamine |
|---|---|
| PubChem CID | 143195376 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | N,N-dimethyl-1-[4-(2,2,5,5-tetramethylhexan-3-yl)cyclohepta-1,3,5-trien-1-yl]methanamine |
| SMILES | CN(C)CC1=CC=C(C(CC(C)(C)C)C(C)(C)C)C=CC1 |
| InChI | InChI=1S/C20H35N/c1-19(2,3)14-18(20(4,5)6)17-11-9-10-16(12-13-17)15-21(7)8/h9,11-13,18H,10,14-15H2,1-8H3 |
| InChIKey | JTPJDRXIJFLYEE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |