C29H37FN8O2 — CID 143195425
4-(3-ethyl-4-fluorophenyl)-6-[4-(3-methyl-5-nitro-2-pyridinyl)piperazin-1-yl]-2-(4-propylpiperazin-1-yl)pyrimidine (PubChem CID 143195425) has the molecular formula C29H37FN8O2 and a molecular weight of 548.67 g/mol. Its IUPAC name is 4-(3-ethyl-4-fluorophenyl)-6-[4-(3-methyl-5-nitro-2-pyridinyl)piperazin-1-yl]-2-(4-propylpiperazin-1-yl)pyrimidine.
| Compound Name | 4-(3-ethyl-4-fluorophenyl)-6-[4-(3-methyl-5-nitro-2-pyridinyl)piperazin-1-yl]-2-(4-propylpiperazin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 143195425 |
| Molecular Formula | C29H37FN8O2 |
| Molecular Weight | 548.67 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | 4-(3-ethyl-4-fluorophenyl)-6-[4-(3-methyl-5-nitro-2-pyridinyl)piperazin-1-yl]-2-(4-propylpiperazin-1-yl)pyrimidine |
| SMILES | CCCN1CCN(c2nc(-c3ccc(F)c(CC)c3)cc(N3CCN(c4ncc([N+](=O)[O-])cc4C)CC3)n2)CC1 |
| InChI | InChI=1S/C29H37FN8O2/c1-4-8-34-9-11-37(12-10-34)29-32-26(23-6-7-25(30)22(5-2)18-23)19-27(33-29)35-13-15-36(16-14-35)28-21(3)17-24(20-31-28)38(39)40/h6-7,17-20H,4-5,8-16H2,1-3H3 |
| InChIKey | VGDOHWZUCLKQAT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 94.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.67 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|