C29H38N6O4S — CID 143195680
N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-1-methyl-7-[(4-oxamoylpiperazin-1-yl)methyl]indole-2-carboxamide (PubChem CID 143195680) has the molecular formula C29H38N6O4S and a molecular weight of 566.73 g/mol. Its IUPAC name is N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-1-methyl-7-[(4-oxamoylpiperazin-1-yl)methyl]indole-2-carboxamide.
| Compound Name | N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-1-methyl-7-[(4-oxamoylpiperazin-1-yl)methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 143195680 |
| Molecular Formula | C29H38N6O4S |
| Molecular Weight | 566.73 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-1-methyl-7-[(4-oxamoylpiperazin-1-yl)methyl]indole-2-carboxamide |
| SMILES | COc1c(NSC)cc(C(C)(C)C)cc1NC(=O)c1cc2cccc(CN3CCN(C(=O)C(N)=O)CC3)c2n1C |
| InChI | InChI=1S/C29H38N6O4S/c1-29(2,3)20-15-21(25(39-5)22(16-20)32-40-6)31-27(37)23-14-18-8-7-9-19(24(18)33(23)4)17-34-10-12-35(13-11-34)28(38)26(30)36/h7-9,14-16,32H,10-13,17H2,1-6H3,(H2,30,36)(H,31,37) |
| InChIKey | PFVZTGLCEMXNBF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.73 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|