C29H40N4O2S — CID 91154168
7-(azepan-4-ylmethyl)-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-1-methylindole-2-carboxamide (PubChem CID 91154168) has the molecular formula C29H40N4O2S and a molecular weight of 508.73 g/mol. Its IUPAC name is 7-(azepan-4-ylmethyl)-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-1-methylindole-2-carboxamide.
| Compound Name | 7-(azepan-4-ylmethyl)-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 91154168 |
| Molecular Formula | C29H40N4O2S |
| Molecular Weight | 508.73 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | 7-(azepan-4-ylmethyl)-N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-1-methylindole-2-carboxamide |
| SMILES | COc1c(NSC)cc(C(C)(C)C)cc1NC(=O)c1cc2cccc(CC3CCCNCC3)c2n1C |
| InChI | InChI=1S/C29H40N4O2S/c1-29(2,3)22-17-23(27(35-5)24(18-22)32-36-6)31-28(34)25-16-21-11-7-10-20(26(21)33(25)4)15-19-9-8-13-30-14-12-19/h7,10-11,16-19,30,32H,8-9,12-15H2,1-6H3,(H,31,34) |
| InChIKey | MDMMNAMYGSOTLJ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 67.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.73 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|