C29H36ClN5O3S — CID 143951198
N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-chloro-3-[6-(piperidin-4-ylmethyl)pyrimidin-4-yl]oxybenzamide (PubChem CID 143951198) has the molecular formula C29H36ClN5O3S and a molecular weight of 570.16 g/mol. Its IUPAC name is N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-chloro-3-[6-(piperidin-4-ylmethyl)pyrimidin-4-yl]oxybenzamide.
| Compound Name | N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-chloro-3-[6-(piperidin-4-ylmethyl)pyrimidin-4-yl]oxybenzamide |
|---|---|
| PubChem CID | 143951198 |
| Molecular Formula | C29H36ClN5O3S |
| Molecular Weight | 570.16 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | N-[5-tert-butyl-2-methoxy-3-(methylsulfanylamino)phenyl]-4-chloro-3-[6-(piperidin-4-ylmethyl)pyrimidin-4-yl]oxybenzamide |
| SMILES | COc1c(NSC)cc(C(C)(C)C)cc1NC(=O)c1ccc(Cl)c(Oc2cc(CC3CCNCC3)ncn2)c1 |
| InChI | InChI=1S/C29H36ClN5O3S/c1-29(2,3)20-14-23(27(37-4)24(15-20)35-39-5)34-28(36)19-6-7-22(30)25(13-19)38-26-16-21(32-17-33-26)12-18-8-10-31-11-9-18/h6-7,13-18,31,35H,8-12H2,1-5H3,(H,34,36) |
| InChIKey | BFRKNAJLGCWBMM-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.16 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|