C29H31F5N4O5S — CID 87313743
N-[3-(methanesulfonamido)-2-methoxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]-4-methyl-3-[[2-(piperidin-4-ylmethyl)-4-pyridinyl]oxy]benzamide (PubChem CID 87313743) has the molecular formula C29H31F5N4O5S and a molecular weight of 642.65 g/mol. Its IUPAC name is N-[3-(methanesulfonamido)-2-methoxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]-4-methyl-3-[[2-(piperidin-4-ylmethyl)-4-pyridinyl]oxy]benzamide.
| Compound Name | N-[3-(methanesulfonamido)-2-methoxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]-4-methyl-3-[[2-(piperidin-4-ylmethyl)-4-pyridinyl]oxy]benzamide |
|---|---|
| PubChem CID | 87313743 |
| Molecular Formula | C29H31F5N4O5S |
| Molecular Weight | 642.65 g/mol |
| Exact Mass | 642.19 |
| IUPAC Name | N-[3-(methanesulfonamido)-2-methoxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]-4-methyl-3-[[2-(piperidin-4-ylmethyl)-4-pyridinyl]oxy]benzamide |
| SMILES | COc1c(NC(=O)c2ccc(C)c(Oc3ccnc(CC4CCNCC4)c3)c2)cc(C(F)(F)C(F)(F)F)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C29H31F5N4O5S/c1-17-4-5-19(13-25(17)43-22-8-11-36-21(16-22)12-18-6-9-35-10-7-18)27(39)37-23-14-20(28(30,31)29(32,33)34)15-24(26(23)42-2)38-44(3,40)41/h4-5,8,11,13-16,18,35,38H,6-7,9-10,12H2,1-3H3,(H,37,39) |
| InChIKey | DOFVQCOFPCNJAO-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.65 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|