C11H15Br2NO2 — CID 143195940
1-[(1S,5R)-6,6-dibromo-3-propanoyl-3-azabicyclo[3.1.0]hexan-2-yl]propan-1-one (PubChem CID 143195940) has the molecular formula C11H15Br2NO2 and a molecular weight of 353.05 g/mol. Its IUPAC name is 1-[(1S,5R)-6,6-dibromo-3-propanoyl-3-azabicyclo[3.1.0]hexan-2-yl]propan-1-one.
| Compound Name | 1-[(1S,5R)-6,6-dibromo-3-propanoyl-3-azabicyclo[3.1.0]hexan-2-yl]propan-1-one |
|---|---|
| PubChem CID | 143195940 |
| Molecular Formula | C11H15Br2NO2 |
| Molecular Weight | 353.05 g/mol |
| Exact Mass | 350.95 |
| IUPAC Name | 1-[(1S,5R)-6,6-dibromo-3-propanoyl-3-azabicyclo[3.1.0]hexan-2-yl]propan-1-one |
| SMILES | CCC(=O)C1[C@@H]2[C@H](CN1C(=O)CC)C2(Br)Br |
| InChI | InChI=1S/C11H15Br2NO2/c1-3-7(15)10-9-6(11(9,12)13)5-14(10)8(16)4-2/h6,9-10H,3-5H2,1-2H3/t6-,9-,10?/m0/s1 |
| InChIKey | XSHLWGCNMXIRIV-DYFXTIRLSA-N |
| XLogP | 2.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.05 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|