C12H19Cl2NO2 — CID 143104827
1-[(1S,5R)-2-acetyl-6,6-dichloro-3-azabicyclo[3.1.0]hexan-3-yl]propan-1-one;ethane (PubChem CID 143104827) has the molecular formula C12H19Cl2NO2 and a molecular weight of 280.19 g/mol. Its IUPAC name is 1-[(1S,5R)-2-acetyl-6,6-dichloro-3-azabicyclo[3.1.0]hexan-3-yl]propan-1-one;ethane.
| Compound Name | 1-[(1S,5R)-2-acetyl-6,6-dichloro-3-azabicyclo[3.1.0]hexan-3-yl]propan-1-one;ethane |
|---|---|
| PubChem CID | 143104827 |
| Molecular Formula | C12H19Cl2NO2 |
| Molecular Weight | 280.19 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 1-[(1S,5R)-2-acetyl-6,6-dichloro-3-azabicyclo[3.1.0]hexan-3-yl]propan-1-one;ethane |
| SMILES | CC.CCC(=O)N1C[C@H]2[C@@H](C1C(C)=O)C2(Cl)Cl |
| InChI | InChI=1S/C10H13Cl2NO2.C2H6/c1-3-7(15)13-4-6-8(10(6,11)12)9(13)5(2)14;1-2/h6,8-9H,3-4H2,1-2H3;1-2H3/t6-,8-,9?;/m0./s1 |
| InChIKey | JCPHPBUEHGTQFQ-JHJDJNCLSA-N |
| XLogP | 2.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.19 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|