C14H20Cl4F3NO4 — CID 90964926
tert-butyl (1S,2R,5R)-6,6-dichloro-2-methyl-3-azabicyclo[3.1.0]hexane-3-carboxylate;dichloromethane;2,2,2-trifluoroacetic acid (PubChem CID 90964926) has the molecular formula C14H20Cl4F3NO4 and a molecular weight of 465.12 g/mol. Its IUPAC name is tert-butyl (1S,2R,5R)-6,6-dichloro-2-methyl-3-azabicyclo[3.1.0]hexane-3-carboxylate;dichloromethane;2,2,2-trifluoroacetic acid.
| Compound Name | tert-butyl (1S,2R,5R)-6,6-dichloro-2-methyl-3-azabicyclo[3.1.0]hexane-3-carboxylate;dichloromethane;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 90964926 |
| Molecular Formula | C14H20Cl4F3NO4 |
| Molecular Weight | 465.12 g/mol |
| Exact Mass | 463.01 |
| IUPAC Name | tert-butyl (1S,2R,5R)-6,6-dichloro-2-methyl-3-azabicyclo[3.1.0]hexane-3-carboxylate;dichloromethane;2,2,2-trifluoroacetic acid |
| SMILES | C[C@@H]1[C@@H]2[C@H](CN1C(=O)OC(C)(C)C)C2(Cl)Cl.ClCCl.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H17Cl2NO2.C2HF3O2.CH2Cl2/c1-6-8-7(11(8,12)13)5-14(6)9(15)16-10(2,3)4;3-2(4,5)1(6)7;2-1-3/h6-8H,5H2,1-4H3;(H,6,7);1H2/t6-,7+,8-;;/m1../s1 |
| InChIKey | PWBPUVBOSNGIOD-ZEQLNYICSA-N |
| XLogP | 5.10 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.12 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|