C29H33N5O2S — CID 143197818
(E)-N-[1-[2-(4-anilinophenyl)morpholin-4-yl]ethenyl]-N-methyl-3-pyridin-4-ylbut-2-enamide;methanethioamide (PubChem CID 143197818) has the molecular formula C29H33N5O2S and a molecular weight of 515.68 g/mol. Its IUPAC name is (E)-N-[1-[2-(4-anilinophenyl)morpholin-4-yl]ethenyl]-N-methyl-3-pyridin-4-ylbut-2-enamide;methanethioamide.
| Compound Name | (E)-N-[1-[2-(4-anilinophenyl)morpholin-4-yl]ethenyl]-N-methyl-3-pyridin-4-ylbut-2-enamide;methanethioamide |
|---|---|
| PubChem CID | 143197818 |
| Molecular Formula | C29H33N5O2S |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | (E)-N-[1-[2-(4-anilinophenyl)morpholin-4-yl]ethenyl]-N-methyl-3-pyridin-4-ylbut-2-enamide;methanethioamide |
| SMILES | C=C(N1CCOC(c2ccc(Nc3ccccc3)cc2)C1)N(C)C(=O)/C=C(\C)c1ccncc1.NC=S |
| InChI | InChI=1S/C28H30N4O2.CH3NS/c1-21(23-13-15-29-16-14-23)19-28(33)31(3)22(2)32-17-18-34-27(20-32)24-9-11-26(12-10-24)30-25-7-5-4-6-8-25;2-1-3/h4-16,19,27,30H,2,17-18,20H2,1,3H3;1H,(H2,2,3)/b21-19+; |
| InChIKey | ZDBCOYXLCBNDLL-UXJRWBAGSA-N |
| XLogP | 5.13 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|