C28H31N5OP+ — CID 143198401
N-[1-[7-methyl-2-(2-phosphanylphenyl)quinazolin-3-ium-4-yl]piperidin-4-yl]-3-pyridin-2-ylpropanamide (PubChem CID 143198401) has the molecular formula C28H31N5OP+ and a molecular weight of 484.56 g/mol. Its IUPAC name is N-[1-[7-methyl-2-(2-phosphanylphenyl)quinazolin-3-ium-4-yl]piperidin-4-yl]-3-pyridin-2-ylpropanamide.
| Compound Name | N-[1-[7-methyl-2-(2-phosphanylphenyl)quinazolin-3-ium-4-yl]piperidin-4-yl]-3-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 143198401 |
| Molecular Formula | C28H31N5OP+ |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | N-[1-[7-methyl-2-(2-phosphanylphenyl)quinazolin-3-ium-4-yl]piperidin-4-yl]-3-pyridin-2-ylpropanamide |
| SMILES | Cc1ccc2c(N3CCC(NC(=O)CCc4ccccn4)CC3)[nH+]c(-c3ccccc3P)nc2c1 |
| InChI | InChI=1S/C28H30N5OP/c1-19-9-11-22-24(18-19)31-27(23-7-2-3-8-25(23)35)32-28(22)33-16-13-21(14-17-33)30-26(34)12-10-20-6-4-5-15-29-20/h2-9,11,15,18,21H,10,12-14,16-17,35H2,1H3,(H,30,34)/p+1 |
| InChIKey | UJWXTYKVHPKPHF-UHFFFAOYSA-O |
| XLogP | 3.64 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|