C9H16F3NO — CID 143198841
ethane;2,2,2-trifluoro-N-methyl-N-(2-methylprop-2-enyl)acetamide (PubChem CID 143198841) has the molecular formula C9H16F3NO and a molecular weight of 211.23 g/mol. Its IUPAC name is ethane;2,2,2-trifluoro-N-methyl-N-(2-methylprop-2-enyl)acetamide.
| Compound Name | ethane;2,2,2-trifluoro-N-methyl-N-(2-methylprop-2-enyl)acetamide |
|---|---|
| PubChem CID | 143198841 |
| Molecular Formula | C9H16F3NO |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | ethane;2,2,2-trifluoro-N-methyl-N-(2-methylprop-2-enyl)acetamide |
| SMILES | C=C(C)CN(C)C(=O)C(F)(F)F.CC |
| InChI | InChI=1S/C7H10F3NO.C2H6/c1-5(2)4-11(3)6(12)7(8,9)10;1-2/h1,4H2,2-3H3;1-2H3 |
| InChIKey | AIBHYRDFBASVOI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|