C10H15F4NO — CID 89314896
2-methyl-N-propyl-N-(2,2,3,3-tetrafluoropropyl)prop-2-enamide (PubChem CID 89314896) has the molecular formula C10H15F4NO and a molecular weight of 241.23 g/mol. Its IUPAC name is 2-methyl-N-propyl-N-(2,2,3,3-tetrafluoropropyl)prop-2-enamide.
| Compound Name | 2-methyl-N-propyl-N-(2,2,3,3-tetrafluoropropyl)prop-2-enamide |
|---|---|
| PubChem CID | 89314896 |
| Molecular Formula | C10H15F4NO |
| Molecular Weight | 241.23 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2-methyl-N-propyl-N-(2,2,3,3-tetrafluoropropyl)prop-2-enamide |
| SMILES | C=C(C)C(=O)N(CCC)CC(F)(F)C(F)F |
| InChI | InChI=1S/C10H15F4NO/c1-4-5-15(8(16)7(2)3)6-10(13,14)9(11)12/h9H,2,4-6H2,1,3H3 |
| InChIKey | NCBZFIJTARKLOW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|