C9H14F4N2O2 — CID 103733151
2,2,3,3-tetrafluoro-N-[2-(methylamino)-2-oxoethyl]-N-propylpropanamide (PubChem CID 103733151) has the molecular formula C9H14F4N2O2 and a molecular weight of 258.21 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[2-(methylamino)-2-oxoethyl]-N-propylpropanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[2-(methylamino)-2-oxoethyl]-N-propylpropanamide |
|---|---|
| PubChem CID | 103733151 |
| Molecular Formula | C9H14F4N2O2 |
| Molecular Weight | 258.21 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[2-(methylamino)-2-oxoethyl]-N-propylpropanamide |
| SMILES | CCCN(CC(=O)NC)C(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H14F4N2O2/c1-3-4-15(5-6(16)14-2)8(17)9(12,13)7(10)11/h7H,3-5H2,1-2H3,(H,14,16) |
| InChIKey | CSTHFRFAFGQWDK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|