C14H17F4NO — CID 103732461
2,2,3,3-tetrafluoro-N-[(4-methylphenyl)methyl]-N-propylpropanamide (PubChem CID 103732461) has the molecular formula C14H17F4NO and a molecular weight of 291.29 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[(4-methylphenyl)methyl]-N-propylpropanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[(4-methylphenyl)methyl]-N-propylpropanamide |
|---|---|
| PubChem CID | 103732461 |
| Molecular Formula | C14H17F4NO |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[(4-methylphenyl)methyl]-N-propylpropanamide |
| SMILES | CCCN(Cc1ccc(C)cc1)C(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H17F4NO/c1-3-8-19(13(20)14(17,18)12(15)16)9-11-6-4-10(2)5-7-11/h4-7,12H,3,8-9H2,1-2H3 |
| InChIKey | YEQCHHXNJKEKIA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|