C29H25ClF3N5O3 — CID 143198901
1-[4-[(4-chloro-3-pyridin-2-ylphenyl)carbamoyl]-2-[[2-methyl-6-(trifluoromethyl)pyridine-3-carbonyl]amino]phenyl]-N,N-dimethylmethanamine oxide (PubChem CID 143198901) has the molecular formula C29H25ClF3N5O3 and a molecular weight of 584.00 g/mol. Its IUPAC name is 1-[4-[(4-chloro-3-pyridin-2-ylphenyl)carbamoyl]-2-[[2-methyl-6-(trifluoromethyl)pyridine-3-carbonyl]amino]phenyl]-N,N-dimethylmethanamine oxide.
| Compound Name | 1-[4-[(4-chloro-3-pyridin-2-ylphenyl)carbamoyl]-2-[[2-methyl-6-(trifluoromethyl)pyridine-3-carbonyl]amino]phenyl]-N,N-dimethylmethanamine oxide |
|---|---|
| PubChem CID | 143198901 |
| Molecular Formula | C29H25ClF3N5O3 |
| Molecular Weight | 584.00 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | 1-[4-[(4-chloro-3-pyridin-2-ylphenyl)carbamoyl]-2-[[2-methyl-6-(trifluoromethyl)pyridine-3-carbonyl]amino]phenyl]-N,N-dimethylmethanamine oxide |
| SMILES | Cc1nc(C(F)(F)F)ccc1C(=O)Nc1cc(C(=O)Nc2ccc(Cl)c(-c3ccccn3)c2)ccc1C[N+](C)(C)[O-] |
| InChI | InChI=1S/C29H25ClF3N5O3/c1-17-21(10-12-26(35-17)29(31,32)33)28(40)37-25-14-18(7-8-19(25)16-38(2,3)41)27(39)36-20-9-11-23(30)22(15-20)24-6-4-5-13-34-24/h4-15H,16H2,1-3H3,(H,36,39)(H,37,40) |
| InChIKey | GZOXNRYHYRKSGS-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 107.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.00 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|