C19H26N4OS2 — CID 143199121
2-prop-1-en-2-ylsulfanyl-N-[6-[(5-thiophen-2-yl-1H-pyrazol-3-yl)amino]hept-6-enyl]acetamide (PubChem CID 143199121) has the molecular formula C19H26N4OS2 and a molecular weight of 390.58 g/mol. Its IUPAC name is 2-prop-1-en-2-ylsulfanyl-N-[6-[(5-thiophen-2-yl-1H-pyrazol-3-yl)amino]hept-6-enyl]acetamide.
| Compound Name | 2-prop-1-en-2-ylsulfanyl-N-[6-[(5-thiophen-2-yl-1H-pyrazol-3-yl)amino]hept-6-enyl]acetamide |
|---|---|
| PubChem CID | 143199121 |
| Molecular Formula | C19H26N4OS2 |
| Molecular Weight | 390.58 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 2-prop-1-en-2-ylsulfanyl-N-[6-[(5-thiophen-2-yl-1H-pyrazol-3-yl)amino]hept-6-enyl]acetamide |
| SMILES | C=C(CCCCCNC(=O)CSC(=C)C)Nc1cc(-c2cccs2)[nH]n1 |
| InChI | InChI=1S/C19H26N4OS2/c1-14(2)26-13-19(24)20-10-6-4-5-8-15(3)21-18-12-16(22-23-18)17-9-7-11-25-17/h7,9,11-12H,1,3-6,8,10,13H2,2H3,(H,20,24)(H2,21,22,23) |
| InChIKey | KHONADMPDFEGMI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|