C11H17N3S — CID 143199498
N'-methylpropane-1,3-diamine;2-sulfanylbenzonitrile (PubChem CID 143199498) has the molecular formula C11H17N3S and a molecular weight of 223.35 g/mol. Its IUPAC name is N'-methylpropane-1,3-diamine;2-sulfanylbenzonitrile.
| Compound Name | N'-methylpropane-1,3-diamine;2-sulfanylbenzonitrile |
|---|---|
| PubChem CID | 143199498 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.35 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | N'-methylpropane-1,3-diamine;2-sulfanylbenzonitrile |
| SMILES | CNCCCN.N#Cc1ccccc1S |
| InChI | InChI=1S/C7H5NS.C4H12N2/c8-5-6-3-1-2-4-7(6)9;1-6-4-2-3-5/h1-4,9H;6H,2-5H2,1H3 |
| InChIKey | VOVKSLXOFGYUFM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|