C27H31N5O6S — CID 143200047
methyl 2-[[3-[4-(dimethylamino)phenyl]-2-[formyl-[[(1S)-1-(4-methoxyphenyl)ethyl]carbamoyl]amino]propanoyl]amino]-1,3-thiazole-4-carboxylate (PubChem CID 143200047) has the molecular formula C27H31N5O6S and a molecular weight of 553.64 g/mol. Its IUPAC name is methyl 2-[[3-[4-(dimethylamino)phenyl]-2-[formyl-[[(1S)-1-(4-methoxyphenyl)ethyl]carbamoyl]amino]propanoyl]amino]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[[3-[4-(dimethylamino)phenyl]-2-[formyl-[[(1S)-1-(4-methoxyphenyl)ethyl]carbamoyl]amino]propanoyl]amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 143200047 |
| Molecular Formula | C27H31N5O6S |
| Molecular Weight | 553.64 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | methyl 2-[[3-[4-(dimethylamino)phenyl]-2-[formyl-[[(1S)-1-(4-methoxyphenyl)ethyl]carbamoyl]amino]propanoyl]amino]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(NC(=O)C(Cc2ccc(N(C)C)cc2)N(C=O)C(=O)N[C@@H](C)c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C27H31N5O6S/c1-17(19-8-12-21(37-4)13-9-19)28-27(36)32(16-33)23(14-18-6-10-20(11-7-18)31(2)3)24(34)30-26-29-22(15-39-26)25(35)38-5/h6-13,15-17,23H,14H2,1-5H3,(H,28,36)(H,29,30,34)/t17-,23?/m0/s1 |
| InChIKey | CLZBUNORHGXBQK-NVHKAFQKSA-N |
| XLogP | 3.48 |
| TPSA | 130.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.64 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|