C31H30N4O5S — CID 143200033
methyl 2-[[(2S)-2-[formyl(1-phenylpropylcarbamoyl)amino]-3-(4-phenylphenyl)propanoyl]amino]-1,3-thiazole-4-carboxylate (PubChem CID 143200033) has the molecular formula C31H30N4O5S and a molecular weight of 570.67 g/mol. Its IUPAC name is methyl 2-[[(2S)-2-[formyl(1-phenylpropylcarbamoyl)amino]-3-(4-phenylphenyl)propanoyl]amino]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[[(2S)-2-[formyl(1-phenylpropylcarbamoyl)amino]-3-(4-phenylphenyl)propanoyl]amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 143200033 |
| Molecular Formula | C31H30N4O5S |
| Molecular Weight | 570.67 g/mol |
| Exact Mass | 570.19 |
| IUPAC Name | methyl 2-[[(2S)-2-[formyl(1-phenylpropylcarbamoyl)amino]-3-(4-phenylphenyl)propanoyl]amino]-1,3-thiazole-4-carboxylate |
| SMILES | CCC(NC(=O)N(C=O)[C@@H](Cc1ccc(-c2ccccc2)cc1)C(=O)Nc1nc(C(=O)OC)cs1)c1ccccc1 |
| InChI | InChI=1S/C31H30N4O5S/c1-3-25(24-12-8-5-9-13-24)33-31(39)35(20-36)27(28(37)34-30-32-26(19-41-30)29(38)40-2)18-21-14-16-23(17-15-21)22-10-6-4-7-11-22/h4-17,19-20,25,27H,3,18H2,1-2H3,(H,33,39)(H,32,34,37)/t25?,27-/m0/s1 |
| InChIKey | LVGDNEODQURCLL-GPNIZQGCSA-N |
| XLogP | 5.47 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.67 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|