C29H24N4O5S — CID 72995078
methyl 2-[[2-(2,5-dioxo-4-phenylimidazolidin-1-yl)-3-(4-phenylphenyl)propanoyl]amino]-1,3-thiazole-4-carboxylate (PubChem CID 72995078) has the molecular formula C29H24N4O5S and a molecular weight of 540.60 g/mol. Its IUPAC name is methyl 2-[[2-(2,5-dioxo-4-phenylimidazolidin-1-yl)-3-(4-phenylphenyl)propanoyl]amino]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[[2-(2,5-dioxo-4-phenylimidazolidin-1-yl)-3-(4-phenylphenyl)propanoyl]amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 72995078 |
| Molecular Formula | C29H24N4O5S |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | methyl 2-[[2-(2,5-dioxo-4-phenylimidazolidin-1-yl)-3-(4-phenylphenyl)propanoyl]amino]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(NC(=O)C(Cc2ccc(-c3ccccc3)cc2)N2C(=O)NC(c3ccccc3)C2=O)n1 |
| InChI | InChI=1S/C29H24N4O5S/c1-38-27(36)22-17-39-28(30-22)32-25(34)23(16-18-12-14-20(15-13-18)19-8-4-2-5-9-19)33-26(35)24(31-29(33)37)21-10-6-3-7-11-21/h2-15,17,23-24H,16H2,1H3,(H,31,37)(H,30,32,34) |
| InChIKey | WDRZISWDNUUFLG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|