C23H20N4O5S — CID 72997336
methyl 2-[[2-(2,5-dioxo-4-phenylimidazolidin-1-yl)-3-phenylpropanoyl]amino]-1,3-thiazole-4-carboxylate (PubChem CID 72997336) has the molecular formula C23H20N4O5S and a molecular weight of 464.50 g/mol. Its IUPAC name is methyl 2-[[2-(2,5-dioxo-4-phenylimidazolidin-1-yl)-3-phenylpropanoyl]amino]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[[2-(2,5-dioxo-4-phenylimidazolidin-1-yl)-3-phenylpropanoyl]amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 72997336 |
| Molecular Formula | C23H20N4O5S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | methyl 2-[[2-(2,5-dioxo-4-phenylimidazolidin-1-yl)-3-phenylpropanoyl]amino]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(NC(=O)C(Cc2ccccc2)N2C(=O)NC(c3ccccc3)C2=O)n1 |
| InChI | InChI=1S/C23H20N4O5S/c1-32-21(30)16-13-33-22(24-16)26-19(28)17(12-14-8-4-2-5-9-14)27-20(29)18(25-23(27)31)15-10-6-3-7-11-15/h2-11,13,17-18H,12H2,1H3,(H,25,31)(H,24,26,28) |
| InChIKey | QPMYMFWZQIRUTN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|