C25H25N5O6S — CID 58615474
N-methoxy-2-[[(2S)-2-[(4R)-4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-3-phenylpropanoyl]amino]-N-methyl-1,3-thiazole-4-carboxamide (PubChem CID 58615474) has the molecular formula C25H25N5O6S and a molecular weight of 523.57 g/mol. Its IUPAC name is N-methoxy-2-[[(2S)-2-[(4R)-4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-3-phenylpropanoyl]amino]-N-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-methoxy-2-[[(2S)-2-[(4R)-4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-3-phenylpropanoyl]amino]-N-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 58615474 |
| Molecular Formula | C25H25N5O6S |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | N-methoxy-2-[[(2S)-2-[(4R)-4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-3-phenylpropanoyl]amino]-N-methyl-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc([C@H]2NC(=O)N([C@@H](Cc3ccccc3)C(=O)Nc3nc(C(=O)N(C)OC)cs3)C2=O)cc1 |
| InChI | InChI=1S/C25H25N5O6S/c1-29(36-3)22(32)18-14-37-24(26-18)28-21(31)19(13-15-7-5-4-6-8-15)30-23(33)20(27-25(30)34)16-9-11-17(35-2)12-10-16/h4-12,14,19-20H,13H2,1-3H3,(H,27,34)(H,26,28,31)/t19-,20+/m0/s1 |
| InChIKey | FOUTXIXIVGJWBH-VQTJNVASSA-N |
| XLogP | 2.63 |
| TPSA | 130.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|