C23H23NO3S — CID 137426881
methyl 2-[2-formyl-5-(4-phenylphenyl)pentyl]-1,3-thiazole-4-carboxylate (PubChem CID 137426881) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is methyl 2-[2-formyl-5-(4-phenylphenyl)pentyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[2-formyl-5-(4-phenylphenyl)pentyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 137426881 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | methyl 2-[2-formyl-5-(4-phenylphenyl)pentyl]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(CC(C=O)CCCc2ccc(-c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C23H23NO3S/c1-27-23(26)21-16-28-22(24-21)14-18(15-25)7-5-6-17-10-12-20(13-11-17)19-8-3-2-4-9-19/h2-4,8-13,15-16,18H,5-7,14H2,1H3 |
| InChIKey | CUSOFRSLGLLTLM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|