C26H36ClFN2O — CID 143200782
2-(3-chloro-5-methylphenyl)-N,2-dimethyl-N-piperidin-4-ylpropanamide;ethene;1-fluoro-3-methylbenzene (PubChem CID 143200782) has the molecular formula C26H36ClFN2O and a molecular weight of 447.04 g/mol. Its IUPAC name is 2-(3-chloro-5-methylphenyl)-N,2-dimethyl-N-piperidin-4-ylpropanamide;ethene;1-fluoro-3-methylbenzene.
| Compound Name | 2-(3-chloro-5-methylphenyl)-N,2-dimethyl-N-piperidin-4-ylpropanamide;ethene;1-fluoro-3-methylbenzene |
|---|---|
| PubChem CID | 143200782 |
| Molecular Formula | C26H36ClFN2O |
| Molecular Weight | 447.04 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 2-(3-chloro-5-methylphenyl)-N,2-dimethyl-N-piperidin-4-ylpropanamide;ethene;1-fluoro-3-methylbenzene |
| SMILES | C=C.Cc1cc(Cl)cc(C(C)(C)C(=O)N(C)C2CCNCC2)c1.Cc1cccc(F)c1 |
| InChI | InChI=1S/C17H25ClN2O.C7H7F.C2H4/c1-12-9-13(11-14(18)10-12)17(2,3)16(21)20(4)15-5-7-19-8-6-15;1-6-3-2-4-7(8)5-6;1-2/h9-11,15,19H,5-8H2,1-4H3;2-5H,1H3;1-2H2 |
| InChIKey | VSFRQYGTPBOGIG-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.04 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|