C19H19ClN4 — CID 143200957
(1R)-2-[5-chloro-2-(pyridin-2-ylmethyl)phenyl]-1-(3-methylimidazol-4-yl)prop-2-en-1-amine (PubChem CID 143200957) has the molecular formula C19H19ClN4 and a molecular weight of 338.84 g/mol. Its IUPAC name is (1R)-2-[5-chloro-2-(pyridin-2-ylmethyl)phenyl]-1-(3-methylimidazol-4-yl)prop-2-en-1-amine.
| Compound Name | (1R)-2-[5-chloro-2-(pyridin-2-ylmethyl)phenyl]-1-(3-methylimidazol-4-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 143200957 |
| Molecular Formula | C19H19ClN4 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (1R)-2-[5-chloro-2-(pyridin-2-ylmethyl)phenyl]-1-(3-methylimidazol-4-yl)prop-2-en-1-amine |
| SMILES | C=C(c1cc(Cl)ccc1Cc1ccccn1)[C@@H](N)c1cncn1C |
| InChI | InChI=1S/C19H19ClN4/c1-13(19(21)18-11-22-12-24(18)2)17-10-15(20)7-6-14(17)9-16-5-3-4-8-23-16/h3-8,10-12,19H,1,9,21H2,2H3/t19-/m1/s1 |
| InChIKey | NBLYBFZZHBEQTD-LJQANCHMSA-N |
| XLogP | 3.77 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |