C21H26ClN3O2 — CID 143201059
N-[(1R)-2-[5-chloro-2-[(Z)-pent-3-enyl]phenyl]-1-(3-methylimidazol-4-yl)prop-2-enyl]-2-methoxyacetamide (PubChem CID 143201059) has the molecular formula C21H26ClN3O2 and a molecular weight of 387.91 g/mol. Its IUPAC name is N-[(1R)-2-[5-chloro-2-[(Z)-pent-3-enyl]phenyl]-1-(3-methylimidazol-4-yl)prop-2-enyl]-2-methoxyacetamide.
| Compound Name | N-[(1R)-2-[5-chloro-2-[(Z)-pent-3-enyl]phenyl]-1-(3-methylimidazol-4-yl)prop-2-enyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 143201059 |
| Molecular Formula | C21H26ClN3O2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | N-[(1R)-2-[5-chloro-2-[(Z)-pent-3-enyl]phenyl]-1-(3-methylimidazol-4-yl)prop-2-enyl]-2-methoxyacetamide |
| SMILES | C=C(c1cc(Cl)ccc1CC/C=C\C)[C@@H](NC(=O)COC)c1cncn1C |
| InChI | InChI=1S/C21H26ClN3O2/c1-5-6-7-8-16-9-10-17(22)11-18(16)15(2)21(24-20(26)13-27-4)19-12-23-14-25(19)3/h5-6,9-12,14,21H,2,7-8,13H2,1,3-4H3,(H,24,26)/b6-5-/t21-/m1/s1 |
| InChIKey | ZAMRHANQMLNPIA-QEVIJRNUSA-N |
| XLogP | 4.10 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|