C25H26N4O — CID 143202737
2-[4-[4-[2-(1H-indol-3-yl)ethylamino]anilino]-3-pyridinyl]butanal (PubChem CID 143202737) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-[4-[4-[2-(1H-indol-3-yl)ethylamino]anilino]-3-pyridinyl]butanal.
| Compound Name | 2-[4-[4-[2-(1H-indol-3-yl)ethylamino]anilino]-3-pyridinyl]butanal |
|---|---|
| PubChem CID | 143202737 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-[4-[4-[2-(1H-indol-3-yl)ethylamino]anilino]-3-pyridinyl]butanal |
| SMILES | CCC(C=O)c1cnccc1Nc1ccc(NCCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C25H26N4O/c1-2-18(17-30)23-16-26-13-12-25(23)29-21-9-7-20(8-10-21)27-14-11-19-15-28-24-6-4-3-5-22(19)24/h3-10,12-13,15-18,27-28H,2,11,14H2,1H3,(H,26,29) |
| InChIKey | MJPZWBMPSMZRHJ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|