C23H23ClFNO3 — CID 143203412
tert-butyl 7-[2-(3-chloro-2-fluorophenyl)ethyl]-3-methyl-4-oxoquinolizine-1-carboxylate (PubChem CID 143203412) has the molecular formula C23H23ClFNO3 and a molecular weight of 415.89 g/mol. Its IUPAC name is tert-butyl 7-[2-(3-chloro-2-fluorophenyl)ethyl]-3-methyl-4-oxoquinolizine-1-carboxylate.
| Compound Name | tert-butyl 7-[2-(3-chloro-2-fluorophenyl)ethyl]-3-methyl-4-oxoquinolizine-1-carboxylate |
|---|---|
| PubChem CID | 143203412 |
| Molecular Formula | C23H23ClFNO3 |
| Molecular Weight | 415.89 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | tert-butyl 7-[2-(3-chloro-2-fluorophenyl)ethyl]-3-methyl-4-oxoquinolizine-1-carboxylate |
| SMILES | Cc1cc(C(=O)OC(C)(C)C)c2ccc(CCc3cccc(Cl)c3F)cn2c1=O |
| InChI | InChI=1S/C23H23ClFNO3/c1-14-12-17(22(28)29-23(2,3)4)19-11-9-15(13-26(19)21(14)27)8-10-16-6-5-7-18(24)20(16)25/h5-7,9,11-13H,8,10H2,1-4H3 |
| InChIKey | LSACTEKPSJKRQL-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.89 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |