C19H16ClFN2O2 — CID 143203388
N-[[7-[(3-chloro-2-fluorophenyl)methyl]-4-oxoquinolizin-1-yl]methyl]acetamide (PubChem CID 143203388) has the molecular formula C19H16ClFN2O2 and a molecular weight of 358.80 g/mol. Its IUPAC name is N-[[7-[(3-chloro-2-fluorophenyl)methyl]-4-oxoquinolizin-1-yl]methyl]acetamide.
| Compound Name | N-[[7-[(3-chloro-2-fluorophenyl)methyl]-4-oxoquinolizin-1-yl]methyl]acetamide |
|---|---|
| PubChem CID | 143203388 |
| Molecular Formula | C19H16ClFN2O2 |
| Molecular Weight | 358.80 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | N-[[7-[(3-chloro-2-fluorophenyl)methyl]-4-oxoquinolizin-1-yl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(=O)n2cc(Cc3cccc(Cl)c3F)ccc12 |
| InChI | InChI=1S/C19H16ClFN2O2/c1-12(24)22-10-15-6-8-18(25)23-11-13(5-7-17(15)23)9-14-3-2-4-16(20)19(14)21/h2-8,11H,9-10H2,1H3,(H,22,24) |
| InChIKey | GNICAQVBZMRDGE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.80 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |