C17H26F3N3O — CID 143203897
N,1-dimethyl-2-(trifluoromethyl)benzimidazol-5-amine;ethane;oxane (PubChem CID 143203897) has the molecular formula C17H26F3N3O and a molecular weight of 345.41 g/mol. Its IUPAC name is N,1-dimethyl-2-(trifluoromethyl)benzimidazol-5-amine;ethane;oxane.
| Compound Name | N,1-dimethyl-2-(trifluoromethyl)benzimidazol-5-amine;ethane;oxane |
|---|---|
| PubChem CID | 143203897 |
| Molecular Formula | C17H26F3N3O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | N,1-dimethyl-2-(trifluoromethyl)benzimidazol-5-amine;ethane;oxane |
| SMILES | C1CCOCC1.CC.CNc1ccc2c(c1)nc(C(F)(F)F)n2C |
| InChI | InChI=1S/C10H10F3N3.C5H10O.C2H6/c1-14-6-3-4-8-7(5-6)15-9(16(8)2)10(11,12)13;1-2-4-6-5-3-1;1-2/h3-5,14H,1-2H3;1-5H2;1-2H3 |
| InChIKey | OBTUCTSEYPISAT-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |