C18H29N3 — CID 58492649
2-tert-butyl-1-methyl-N,N-dipropylbenzimidazol-5-amine (PubChem CID 58492649) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is 2-tert-butyl-1-methyl-N,N-dipropylbenzimidazol-5-amine.
| Compound Name | 2-tert-butyl-1-methyl-N,N-dipropylbenzimidazol-5-amine |
|---|---|
| PubChem CID | 58492649 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | 2-tert-butyl-1-methyl-N,N-dipropylbenzimidazol-5-amine |
| SMILES | CCCN(CCC)c1ccc2c(c1)nc(C(C)(C)C)n2C |
| InChI | InChI=1S/C18H29N3/c1-7-11-21(12-8-2)14-9-10-16-15(13-14)19-17(20(16)6)18(3,4)5/h9-10,13H,7-8,11-12H2,1-6H3 |
| InChIKey | RVVGIYOJTMNHPV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |