C23H29N3O4 — CID 143205901
3-[4-[3-[(1E,3Z)-2-hydroxypenta-1,3-dienyl]-1,4-benzoxazepin-5-yl]piperazin-1-yl]-2,2-dimethylpropanoic acid (PubChem CID 143205901) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is 3-[4-[3-[(1E,3Z)-2-hydroxypenta-1,3-dienyl]-1,4-benzoxazepin-5-yl]piperazin-1-yl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[4-[3-[(1E,3Z)-2-hydroxypenta-1,3-dienyl]-1,4-benzoxazepin-5-yl]piperazin-1-yl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 143205901 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 3-[4-[3-[(1E,3Z)-2-hydroxypenta-1,3-dienyl]-1,4-benzoxazepin-5-yl]piperazin-1-yl]-2,2-dimethylpropanoic acid |
| SMILES | C/C=C\C(O)=C/C1=COc2ccccc2C(N2CCN(CC(C)(C)C(=O)O)CC2)=N1 |
| InChI | InChI=1S/C23H29N3O4/c1-4-7-18(27)14-17-15-30-20-9-6-5-8-19(20)21(24-17)26-12-10-25(11-13-26)16-23(2,3)22(28)29/h4-9,14-15,27H,10-13,16H2,1-3H3,(H,28,29)/b7-4-,18-14+ |
| InChIKey | OMDYFCNFGWRWQE-VNUURWSQSA-N |
| XLogP | 3.41 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|