About ethane;2-(1-hydroxycyclohexyl)-2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile
ethane;2-(1-hydroxycyclohexyl)-2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile (PubChem CID 143207450) has the molecular formula C17H27NO2
and a molecular weight of 277.41 g/mol. Its IUPAC name is ethane;2-(1-hydroxycyclohexyl)-2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile.
Molecular Properties
| Compound Name | ethane;2-(1-hydroxycyclohexyl)-2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile |
| PubChem CID | 143207450 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | ethane;2-(1-hydroxycyclohexyl)-2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile |
| SMILES | CC.COC1C=CC(C(C#N)C2(O)CCCCC2)=CC1 |
| InChI | InChI=1S/C15H21NO2.C2H6/c1-18-13-7-5-12(6-8-13)14(11-16)15(17)9-3-2-4-10-15;1-2/h5-7,13-14,17H,2-4,8-10H2,1H3;1-2H3 |
| InChIKey | OEDLGUXYAULWFL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-(1-hydroxycyclohexyl)-2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(1-hydroxycyclohexyl)-2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile?
The IUPAC name of ethane;2-(1-hydroxycyclohexyl)-2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile (CID 143207450) is ethane;2-(1-hydroxycyclohexyl)-2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile.
What is the SMILES notation for ethane;2-(1-hydroxycyclohexyl)-2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile?
The canonical SMILES for ethane;2-(1-hydroxycyclohexyl)-2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile is CC.COC1C=CC(C(C#N)C2(O)CCCCC2)=CC1.
What is the InChIKey of ethane;2-(1-hydroxycyclohexyl)-2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile?
The InChIKey is OEDLGUXYAULWFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2.C2H6/c1-18-13-7-5-12(6-8-13)14(11-16)15(17)9-3-2-4-10-15;1-2/h5-7,13-14,17H,2-4,8-10H2,1H3;1-2H3.
What are the key properties of ethane;2-(1-hydroxycyclohexyl)-2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile?
ethane;2-(1-hydroxycyclohexyl)-2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile has a molecular weight of 277.41 g/mol, XLogP of 3.75, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(1-hydroxycyclohexyl)-2-(4-methoxycyclohexa-1,5-dien-1-yl)acetonitrile is sourced from PubChem (CID 143207450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).