C28H35FN4O3 — CID 143208558
4-[2,2-dihydroxy-1-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]-N-(4-fluoro-3-methylphenyl)piperidine-1-carboxamide (PubChem CID 143208558) has the molecular formula C28H35FN4O3 and a molecular weight of 494.61 g/mol. Its IUPAC name is 4-[2,2-dihydroxy-1-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]-N-(4-fluoro-3-methylphenyl)piperidine-1-carboxamide.
| Compound Name | 4-[2,2-dihydroxy-1-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]-N-(4-fluoro-3-methylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 143208558 |
| Molecular Formula | C28H35FN4O3 |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 4-[2,2-dihydroxy-1-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]-N-(4-fluoro-3-methylphenyl)piperidine-1-carboxamide |
| SMILES | Cc1cc(NC(=O)N2CCC(C(C(O)O)N3CCC(c4c[nH]c5ccccc45)CC3)CC2)ccc1F |
| InChI | InChI=1S/C28H35FN4O3/c1-18-16-21(6-7-24(18)29)31-28(36)33-14-10-20(11-15-33)26(27(34)35)32-12-8-19(9-13-32)23-17-30-25-5-3-2-4-22(23)25/h2-7,16-17,19-20,26-27,30,34-35H,8-15H2,1H3,(H,31,36) |
| InChIKey | CBWYKOHMYVNURO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|