C13H18F3N3O2S — CID 143211137
N,N,N'-trimethyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylpropane-1,3-diamine (PubChem CID 143211137) has the molecular formula C13H18F3N3O2S and a molecular weight of 337.37 g/mol. Its IUPAC name is N,N,N'-trimethyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylpropane-1,3-diamine.
| Compound Name | N,N,N'-trimethyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylpropane-1,3-diamine |
|---|---|
| PubChem CID | 143211137 |
| Molecular Formula | C13H18F3N3O2S |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N,N,N'-trimethyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylpropane-1,3-diamine |
| SMILES | CN(C)CCCN(C)Sc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18F3N3O2S/c1-17(2)7-4-8-18(3)22-12-6-5-10(13(14,15)16)9-11(12)19(20)21/h5-6,9H,4,7-8H2,1-3H3 |
| InChIKey | JDYMYFGFTWLDRF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|