C10H14O3 — CID 143211196
1-(2,4-dimethoxycyclohexa-1,3-dien-1-yl)ethanone (PubChem CID 143211196) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-(2,4-dimethoxycyclohexa-1,3-dien-1-yl)ethanone.
| Compound Name | 1-(2,4-dimethoxycyclohexa-1,3-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 143211196 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 1-(2,4-dimethoxycyclohexa-1,3-dien-1-yl)ethanone |
| SMILES | COC1=CC(OC)=C(C(C)=O)CC1 |
| InChI | InChI=1S/C10H14O3/c1-7(11)9-5-4-8(12-2)6-10(9)13-3/h6H,4-5H2,1-3H3 |
| InChIKey | BLEHMLFQJMWGNO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |